C25H21ClN4O4S — CID 3760430
2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,5-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 3760430) has the molecular formula C25H21ClN4O4S and a molecular weight of 508.99 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,5-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,5-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3760430 |
| Molecular Formula | C25H21ClN4O4S |
| Molecular Weight | 508.99 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,5-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(C=NNC(=O)CSc2nc3ccccc3c(=O)n2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H21ClN4O4S/c1-33-19-11-12-22(34-2)16(13-19)14-27-29-23(31)15-35-25-28-21-6-4-3-5-20(21)24(32)30(25)18-9-7-17(26)8-10-18/h3-14H,15H2,1-2H3,(H,29,31) |
| InChIKey | IMAANRHRIHNJBW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|