C20H14N6O6S3 — CID 3760538
2-[[4-cyano-3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2-thiazol-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide (PubChem CID 3760538) has the molecular formula C20H14N6O6S3 and a molecular weight of 530.57 g/mol. Its IUPAC name is 2-[[4-cyano-3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2-thiazol-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[[4-cyano-3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2-thiazol-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3760538 |
| Molecular Formula | C20H14N6O6S3 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 2-[[4-cyano-3-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-1,2-thiazol-5-yl]sulfanyl]-N-(4-nitrophenyl)acetamide |
| SMILES | N#Cc1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nsc1SCC(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H14N6O6S3/c21-9-16-19(33-10-17(27)22-12-1-5-14(6-2-12)25(29)30)24-35-20(16)34-11-18(28)23-13-3-7-15(8-4-13)26(31)32/h1-8H,10-11H2,(H,22,27)(H,23,28) |
| InChIKey | OVUPQSDIFQPUMV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 181.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|