C19H19NO — CID 3761095
7-methyl-2-(2,4,5-trimethylphenyl)indolizine-3-carbaldehyde (PubChem CID 3761095) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 7-methyl-2-(2,4,5-trimethylphenyl)indolizine-3-carbaldehyde.
| Compound Name | 7-methyl-2-(2,4,5-trimethylphenyl)indolizine-3-carbaldehyde |
|---|---|
| PubChem CID | 3761095 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 7-methyl-2-(2,4,5-trimethylphenyl)indolizine-3-carbaldehyde |
| SMILES | Cc1ccn2c(C=O)c(-c3cc(C)c(C)cc3C)cc2c1 |
| InChI | InChI=1S/C19H19NO/c1-12-5-6-20-16(7-12)10-18(19(20)11-21)17-9-14(3)13(2)8-15(17)4/h5-11H,1-4H3 |
| InChIKey | OCNNJMHJVFSTKZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|