C26H33NO2 — CID 3794557
2-(3,5-ditert-butyl-4-ethoxyphenyl)-7-methylindolizine-3-carbaldehyde (PubChem CID 3794557) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-ethoxyphenyl)-7-methylindolizine-3-carbaldehyde.
| Compound Name | 2-(3,5-ditert-butyl-4-ethoxyphenyl)-7-methylindolizine-3-carbaldehyde |
|---|---|
| PubChem CID | 3794557 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-ethoxyphenyl)-7-methylindolizine-3-carbaldehyde |
| SMILES | CCOc1c(C(C)(C)C)cc(-c2cc3cc(C)ccn3c2C=O)cc1C(C)(C)C |
| InChI | InChI=1S/C26H33NO2/c1-9-29-24-21(25(3,4)5)13-18(14-22(24)26(6,7)8)20-15-19-12-17(2)10-11-27(19)23(20)16-28/h10-16H,9H2,1-8H3 |
| InChIKey | WPPKQUGFLBKQRL-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|