C22H24N4O4 — CID 3764044
3-(4-aminobutyl)-4,6-dioxo-5-phenyl-1-pyridin-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3764044) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-(4-aminobutyl)-4,6-dioxo-5-phenyl-1-pyridin-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 3-(4-aminobutyl)-4,6-dioxo-5-phenyl-1-pyridin-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3764044 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-(4-aminobutyl)-4,6-dioxo-5-phenyl-1-pyridin-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | NCCCCC1(C(=O)O)NC(c2ccccn2)C2C(=O)N(c3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C22H24N4O4/c23-12-6-5-11-22(21(29)30)17-16(18(25-22)15-10-4-7-13-24-15)19(27)26(20(17)28)14-8-2-1-3-9-14/h1-4,7-10,13,16-18,25H,5-6,11-12,23H2,(H,29,30) |
| InChIKey | IDIXVKGVQYJDCG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|