C11H11FN4OS2 — CID 3765921
1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(3-fluorophenyl)urea (PubChem CID 3765921) has the molecular formula C11H11FN4OS2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(3-fluorophenyl)urea.
| Compound Name | 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 3765921 |
| Molecular Formula | C11H11FN4OS2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-(3-fluorophenyl)urea |
| SMILES | CCSc1nsc(NC(=O)Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C11H11FN4OS2/c1-2-18-11-15-10(19-16-11)14-9(17)13-8-5-3-4-7(12)6-8/h3-6H,2H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | BFKGAYAKPZQXFE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |