C29H24FN3O5 — CID 3766781
1-(4-fluorophenyl)-5-[[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3766781) has the molecular formula C29H24FN3O5 and a molecular weight of 513.53 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-fluorophenyl)-5-[[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3766781 |
| Molecular Formula | C29H24FN3O5 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[[1-[3-(3-methoxyphenoxy)propyl]indol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cccc(OCCCn2cc(C=C3C(=O)NC(=O)N(c4ccc(F)cc4)C3=O)c3ccccc32)c1 |
| InChI | InChI=1S/C29H24FN3O5/c1-37-22-6-4-7-23(17-22)38-15-5-14-32-18-19(24-8-2-3-9-26(24)32)16-25-27(34)31-29(36)33(28(25)35)21-12-10-20(30)11-13-21/h2-4,6-13,16-18H,5,14-15H2,1H3,(H,31,34,36) |
| InChIKey | AJDOAYXMFRBXPH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|