C14H15N7O3 — CID 3769237
8-[(4-methoxyanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 3769237) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 8-[(4-methoxyanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(4-methoxyanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 3769237 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 8-[(4-methoxyanilino)diazenyl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1ccc(NN=Nc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C14H15N7O3/c1-20-11-10(12(22)21(2)14(20)23)15-13(16-11)18-19-17-8-4-6-9(24-3)7-5-8/h4-7H,1-3H3,(H2,15,16,17,18) |
| InChIKey | BQFUAZVTTGKRQY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|