C17H21N5O4 — CID 2818416
7-[2-hydroxy-3-(4-methoxyanilino)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 2818416) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(4-methoxyanilino)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(4-methoxyanilino)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 2818416 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 7-[2-hydroxy-3-(4-methoxyanilino)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COc1ccc(NCC(O)Cn2cnc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C17H21N5O4/c1-20-15-14(16(24)21(2)17(20)25)22(10-19-15)9-12(23)8-18-11-4-6-13(26-3)7-5-11/h4-7,10,12,18,23H,8-9H2,1-3H3 |
| InChIKey | HJBJUUQROIWMFZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|