C15H16N4O3 — CID 135436571
9-(4-hydroxybutyl)-2-phenoxy-1H-purin-6-one (PubChem CID 135436571) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 9-(4-hydroxybutyl)-2-phenoxy-1H-purin-6-one.
| Compound Name | 9-(4-hydroxybutyl)-2-phenoxy-1H-purin-6-one |
|---|---|
| PubChem CID | 135436571 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 9-(4-hydroxybutyl)-2-phenoxy-1H-purin-6-one |
| SMILES | O=c1[nH]c(Oc2ccccc2)nc2c1ncn2CCCCO |
| InChI | InChI=1S/C15H16N4O3/c20-9-5-4-8-19-10-16-12-13(19)17-15(18-14(12)21)22-11-6-2-1-3-7-11/h1-3,6-7,10,20H,4-5,8-9H2,(H,17,18,21) |
| InChIKey | ZANJSOMEOBGPQG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|