C18H23N5O3 — CID 663866
8-(butylamino)-3-methyl-7-(2-phenoxyethyl)purine-2,6-dione (PubChem CID 663866) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 8-(butylamino)-3-methyl-7-(2-phenoxyethyl)purine-2,6-dione.
| Compound Name | 8-(butylamino)-3-methyl-7-(2-phenoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 663866 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 8-(butylamino)-3-methyl-7-(2-phenoxyethyl)purine-2,6-dione |
| SMILES | CCCCNc1nc2c(c(=O)[nH]c(=O)n2C)n1CCOc1ccccc1 |
| InChI | InChI=1S/C18H23N5O3/c1-3-4-10-19-17-20-15-14(16(24)21-18(25)22(15)2)23(17)11-12-26-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3,(H,19,20)(H,21,24,25) |
| InChIKey | APUCCTSFKPXLAN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|