C20H25N3O3 — CID 3771510
11-[4-oxo-4-(4-oxopiperidin-1-yl)but-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 3771510) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 11-[4-oxo-4-(4-oxopiperidin-1-yl)but-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[4-oxo-4-(4-oxopiperidin-1-yl)but-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 3771510 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 11-[4-oxo-4-(4-oxopiperidin-1-yl)but-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C1CCN(C(=O)C=CCN2CC3CC(C2)c2cccc(=O)n2C3)CC1 |
| InChI | InChI=1S/C20H25N3O3/c24-17-6-9-22(10-7-17)19(25)5-2-8-21-12-15-11-16(14-21)18-3-1-4-20(26)23(18)13-15/h1-5,15-16H,6-14H2 |
| InChIKey | ZWJKNBAQFCXDIF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|