C21H29N3O2 — CID 3842085
11-[4-(3-methylpiperidin-1-yl)-4-oxobut-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 3842085) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 11-[4-(3-methylpiperidin-1-yl)-4-oxobut-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[4-(3-methylpiperidin-1-yl)-4-oxobut-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 3842085 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 11-[4-(3-methylpiperidin-1-yl)-4-oxobut-2-enyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CC1CCCN(C(=O)C=CCN2CC3CC(C2)c2cccc(=O)n2C3)C1 |
| InChI | InChI=1S/C21H29N3O2/c1-16-5-3-10-23(12-16)20(25)8-4-9-22-13-17-11-18(15-22)19-6-2-7-21(26)24(19)14-17/h2,4,6-8,16-18H,3,5,9-15H2,1H3 |
| InChIKey | QRMVZVHGIVJMGC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|