C18H15N5O4 — CID 3774931
9-methoxy-N-(4-methoxy-2-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-amine (PubChem CID 3774931) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is 9-methoxy-N-(4-methoxy-2-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-amine.
| Compound Name | 9-methoxy-N-(4-methoxy-2-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-amine |
|---|---|
| PubChem CID | 3774931 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 9-methoxy-N-(4-methoxy-2-nitrophenyl)-5H-pyrimido[5,4-b]indol-4-amine |
| SMILES | COc1ccc(Nc2ncnc3c2[nH]c2cccc(OC)c23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H15N5O4/c1-26-10-6-7-11(13(8-10)23(24)25)22-18-17-16(19-9-20-18)15-12(21-17)4-3-5-14(15)27-2/h3-9,21H,1-2H3,(H,19,20,22) |
| InChIKey | UIMWHJOOHQUWJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|