C14H16N2O3S — CID 3780799
3-(2-morpholin-4-ylethyl)-1,3-benzothiazine-2,4-dione (PubChem CID 3780799) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethyl)-1,3-benzothiazine-2,4-dione.
| Compound Name | 3-(2-morpholin-4-ylethyl)-1,3-benzothiazine-2,4-dione |
|---|---|
| PubChem CID | 3780799 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-(2-morpholin-4-ylethyl)-1,3-benzothiazine-2,4-dione |
| SMILES | O=c1sc2ccccc2c(=O)n1CCN1CCOCC1 |
| InChI | InChI=1S/C14H16N2O3S/c17-13-11-3-1-2-4-12(11)20-14(18)16(13)6-5-15-7-9-19-10-8-15/h1-4H,5-10H2 |
| InChIKey | ZEYJFPZTXYHGKO-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |