C22H24N2O7S — CID 3783694
1-[(4-ethoxyphenyl)methyl]-3-(4-propoxyphenyl)sulfonyl-1,3-diazinane-2,4,6-trione (PubChem CID 3783694) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-3-(4-propoxyphenyl)sulfonyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-3-(4-propoxyphenyl)sulfonyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3783694 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-3-(4-propoxyphenyl)sulfonyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCCOc1ccc(S(=O)(=O)N2C(=O)CC(=O)N(Cc3ccc(OCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H24N2O7S/c1-3-13-31-18-9-11-19(12-10-18)32(28,29)24-21(26)14-20(25)23(22(24)27)15-16-5-7-17(8-6-16)30-4-2/h5-12H,3-4,13-15H2,1-2H3 |
| InChIKey | DRQPJQUWVXCMPZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|