C28H24N4O3 — CID 3784446
methyl 2-cyano-3-[2-(dibenzylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate (PubChem CID 3784446) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is methyl 2-cyano-3-[2-(dibenzylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate.
| Compound Name | methyl 2-cyano-3-[2-(dibenzylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3784446 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | methyl 2-cyano-3-[2-(dibenzylamino)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]prop-2-enoate |
| SMILES | COC(=O)C(C#N)=Cc1c(N(Cc2ccccc2)Cc2ccccc2)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C28H24N4O3/c1-20-10-9-15-32-25(20)30-26(24(27(32)33)16-23(17-29)28(34)35-2)31(18-21-11-5-3-6-12-21)19-22-13-7-4-8-14-22/h3-16H,18-19H2,1-2H3 |
| InChIKey | YAWVSQDEZDHIAQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|