C27H30N6O2 — CID 3737589
2-cyano-3-[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-phenylethyl)prop-2-enamide (PubChem CID 3737589) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-cyano-3-[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-phenylethyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 3737589 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 2-cyano-3-[2-(4-ethylpiperazin-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-(2-phenylethyl)prop-2-enamide |
| SMILES | CCN1CCN(c2nc3c(C)cccn3c(=O)c2C=C(C#N)C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C27H30N6O2/c1-3-31-14-16-32(17-15-31)25-23(27(35)33-13-7-8-20(2)24(33)30-25)18-22(19-28)26(34)29-12-11-21-9-5-4-6-10-21/h4-10,13,18H,3,11-12,14-17H2,1-2H3,(H,29,34) |
| InChIKey | MSBMEMPIMZDJEN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|