C22H27N6O2+ — CID 7459862
(E)-2-cyano-3-[2-(4-ethylpiperazin-4-ium-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-prop-2-enylprop-2-enamide (PubChem CID 7459862) has the molecular formula C22H27N6O2+ and a molecular weight of 407.50 g/mol. Its IUPAC name is (E)-2-cyano-3-[2-(4-ethylpiperazin-4-ium-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-prop-2-enylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2-(4-ethylpiperazin-4-ium-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 7459862 |
| Molecular Formula | C22H27N6O2+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | (E)-2-cyano-3-[2-(4-ethylpiperazin-4-ium-1-yl)-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]-N-prop-2-enylprop-2-enamide |
| SMILES | C=CCNC(=O)/C(C#N)=C/c1c(N2CC[NH+](CC)CC2)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C22H26N6O2/c1-4-8-24-21(29)17(15-23)14-18-20(27-12-10-26(5-2)11-13-27)25-19-16(3)7-6-9-28(19)22(18)30/h4,6-7,9,14H,1,5,8,10-13H2,2-3H3,(H,24,29)/p+1/b17-14+ |
| InChIKey | XTQZWRMBTLWCRW-SAPNQHFASA-O |
| XLogP | -0.06 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|