C27H33N5O2 — CID 3784999
17-[2-(cyclohexen-1-yl)ethyl]-13-(3-ethoxypropyl)-14-ethyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 3784999) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 17-[2-(cyclohexen-1-yl)ethyl]-13-(3-ethoxypropyl)-14-ethyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-[2-(cyclohexen-1-yl)ethyl]-13-(3-ethoxypropyl)-14-ethyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 3784999 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 17-[2-(cyclohexen-1-yl)ethyl]-13-(3-ethoxypropyl)-14-ethyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | CCOCCCn1c(CC)nc2c(c1=O)c1nc3ccccc3nc1n2CCC1=CCCCC1 |
| InChI | InChI=1S/C27H33N5O2/c1-3-22-30-25-23(27(33)31(22)16-10-18-34-4-2)24-26(29-21-14-9-8-13-20(21)28-24)32(25)17-15-19-11-6-5-7-12-19/h8-9,11,13-14H,3-7,10,12,15-18H2,1-2H3 |
| InChIKey | QAJYSRVFDNYFLS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|