C11H22N2O2 — CID 3786773
N-[(2,2-dimethylpropanoylamino)methyl]-2,2-dimethylpropanamide (PubChem CID 3786773) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[(2,2-dimethylpropanoylamino)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[(2,2-dimethylpropanoylamino)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3786773 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-[(2,2-dimethylpropanoylamino)methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-10(2,3)8(14)12-7-13-9(15)11(4,5)6/h7H2,1-6H3,(H,12,14)(H,13,15) |
| InChIKey | IJSFIXHONRJSGX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|