C13H12N4O2S — CID 3790516
3-cyano-N-(3,5-dimethylpyrazin-2-yl)benzenesulfonamide (PubChem CID 3790516) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-cyano-N-(3,5-dimethylpyrazin-2-yl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(3,5-dimethylpyrazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3790516 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-cyano-N-(3,5-dimethylpyrazin-2-yl)benzenesulfonamide |
| SMILES | Cc1cnc(NS(=O)(=O)c2cccc(C#N)c2)c(C)n1 |
| InChI | InChI=1S/C13H12N4O2S/c1-9-8-15-13(10(2)16-9)17-20(18,19)12-5-3-4-11(6-12)7-14/h3-6,8H,1-2H3,(H,15,17) |
| InChIKey | XENLLAGTBCDQRL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |