C10H9N5O3S — CID 83093723
3-cyano-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzenesulfonamide (PubChem CID 83093723) has the molecular formula C10H9N5O3S and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-cyano-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 83093723 |
| Molecular Formula | C10H9N5O3S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-cyano-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzenesulfonamide |
| SMILES | COc1n[nH]c(NS(=O)(=O)c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C10H9N5O3S/c1-18-10-12-9(13-14-10)15-19(16,17)8-4-2-3-7(5-8)6-11/h2-5H,1H3,(H2,12,13,14,15) |
| InChIKey | CKBCXACSHUTLSY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |