C10H9FN4O5S — CID 83096922
2-fluoro-5-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]benzoic acid (PubChem CID 83096922) has the molecular formula C10H9FN4O5S and a molecular weight of 316.27 g/mol. Its IUPAC name is 2-fluoro-5-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-fluoro-5-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 83096922 |
| Molecular Formula | C10H9FN4O5S |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 2-fluoro-5-[(3-methoxy-1H-1,2,4-triazol-5-yl)sulfamoyl]benzoic acid |
| SMILES | COc1n[nH]c(NS(=O)(=O)c2ccc(F)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C10H9FN4O5S/c1-20-10-12-9(13-14-10)15-21(18,19)5-2-3-7(11)6(4-5)8(16)17/h2-4H,1H3,(H,16,17)(H2,12,13,14,15) |
| InChIKey | NCBKPMYDTILJPL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |