C25H26N4O3 — CID 3790670
ethyl 1-[3-[cyano-(4-methoxyphenyl)methyl]quinoxalin-2-yl]piperidine-4-carboxylate (PubChem CID 3790670) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is ethyl 1-[3-[cyano-(4-methoxyphenyl)methyl]quinoxalin-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[cyano-(4-methoxyphenyl)methyl]quinoxalin-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3790670 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl 1-[3-[cyano-(4-methoxyphenyl)methyl]quinoxalin-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc3ccccc3nc2C(C#N)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H26N4O3/c1-3-32-25(30)18-12-14-29(15-13-18)24-23(27-21-6-4-5-7-22(21)28-24)20(16-26)17-8-10-19(31-2)11-9-17/h4-11,18,20H,3,12-15H2,1-2H3 |
| InChIKey | YYWPRBDDQXMVCM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |