C21H24N2OS3 — CID 3792197
5-butylsulfanyl-12,12-dimethyl-4-phenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 3792197) has the molecular formula C21H24N2OS3 and a molecular weight of 416.64 g/mol. Its IUPAC name is 5-butylsulfanyl-12,12-dimethyl-4-phenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-butylsulfanyl-12,12-dimethyl-4-phenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 3792197 |
| Molecular Formula | C21H24N2OS3 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 5-butylsulfanyl-12,12-dimethyl-4-phenyl-8,11-dithia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CCCCSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CC(C)(C)SC3 |
| InChI | InChI=1S/C21H24N2OS3/c1-4-5-11-25-20-22-18-17(15-12-21(2,3)26-13-16(15)27-18)19(24)23(20)14-9-7-6-8-10-14/h6-10H,4-5,11-13H2,1-3H3 |
| InChIKey | AZLDSDPXFFQNFT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|