C16H22N2OS — CID 3793439
ethyl N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanimidate (PubChem CID 3793439) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is ethyl N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanimidate.
| Compound Name | ethyl N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanimidate |
|---|---|
| PubChem CID | 3793439 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | ethyl N-(6-tert-butyl-3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)methanimidate |
| SMILES | CCOC=Nc1sc2c(c1C#N)CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C16H22N2OS/c1-5-19-10-18-15-13(9-17)12-7-6-11(16(2,3)4)8-14(12)20-15/h10-11H,5-8H2,1-4H3 |
| InChIKey | VGJMJPQOSBRXGX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|