About 1-benzyl-4-iodopyrazole
1-benzyl-4-iodopyrazole (PubChem CID 3794579) has the molecular formula C10H9IN2
and a molecular weight of 284.10 g/mol. Its IUPAC name is 1-benzyl-4-iodopyrazole.
Molecular Properties
| Compound Name | 1-benzyl-4-iodopyrazole |
| PubChem CID | 3794579 |
| Molecular Formula | C10H9IN2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1-benzyl-4-iodopyrazole |
| SMILES | Ic1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C10H9IN2/c11-10-6-12-13(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2 |
| InChIKey | PVEYRBGIYMWFPB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-iodopyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-iodopyrazole?
The IUPAC name of 1-benzyl-4-iodopyrazole (CID 3794579) is 1-benzyl-4-iodopyrazole.
What is the SMILES notation for 1-benzyl-4-iodopyrazole?
The canonical SMILES for 1-benzyl-4-iodopyrazole is Ic1cnn(Cc2ccccc2)c1.
What is the InChIKey of 1-benzyl-4-iodopyrazole?
The InChIKey is PVEYRBGIYMWFPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2/c11-10-6-12-13(8-10)7-9-4-2-1-3-5-9/h1-6,8H,7H2.
What are the key properties of 1-benzyl-4-iodopyrazole?
1-benzyl-4-iodopyrazole has a molecular weight of 284.10 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-iodopyrazole is sourced from PubChem (CID 3794579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).