C29H38FN3O4S — CID 3797788
N-[4-[2-(cyclohexylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]-3-fluorobenzamide (PubChem CID 3797788) has the molecular formula C29H38FN3O4S and a molecular weight of 543.71 g/mol. Its IUPAC name is N-[4-[2-(cyclohexylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]-3-fluorobenzamide.
| Compound Name | N-[4-[2-(cyclohexylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 3797788 |
| Molecular Formula | C29H38FN3O4S |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | N-[4-[2-(cyclohexylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]-3-fluorobenzamide |
| SMILES | CC1(CO)C(O)CCC2(C)C(CC(=O)NC3CCCCC3)c3nc(NC(=O)c4cccc(F)c4)sc3CC12 |
| InChI | InChI=1S/C29H38FN3O4S/c1-28-12-11-23(35)29(2,16-34)22(28)15-21-25(20(28)14-24(36)31-19-9-4-3-5-10-19)32-27(38-21)33-26(37)17-7-6-8-18(30)13-17/h6-8,13,19-20,22-23,34-35H,3-5,9-12,14-16H2,1-2H3,(H,31,36)(H,32,33,37) |
| InChIKey | PJZXQFNXJNEYNQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |