C27H35ClN4O4S — CID 3470715
2-chloro-N-[4-[2-(cyclopentylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]pyridine-4-carboxamide (PubChem CID 3470715) has the molecular formula C27H35ClN4O4S and a molecular weight of 547.12 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-(cyclopentylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-[2-(cyclopentylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 3470715 |
| Molecular Formula | C27H35ClN4O4S |
| Molecular Weight | 547.12 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 2-chloro-N-[4-[2-(cyclopentylamino)-2-oxoethyl]-7-hydroxy-8-(hydroxymethyl)-4a,8-dimethyl-4,5,6,7,8a,9-hexahydrobenzo[f][1,3]benzothiazol-2-yl]pyridine-4-carboxamide |
| SMILES | CC1(CO)C(O)CCC2(C)C(CC(=O)NC3CCCC3)c3nc(NC(=O)c4ccnc(Cl)c4)sc3CC12 |
| InChI | InChI=1S/C27H35ClN4O4S/c1-26-9-7-20(34)27(2,14-33)19(26)13-18-23(17(26)12-22(35)30-16-5-3-4-6-16)31-25(37-18)32-24(36)15-8-10-29-21(28)11-15/h8,10-11,16-17,19-20,33-34H,3-7,9,12-14H2,1-2H3,(H,30,35)(H,31,32,36) |
| InChIKey | HPIYDGJVRABCBD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.12 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|