C8H17NO3S — CID 3798667
(1,1,4-trimethylpyrrolidin-1-ium-3-yl)methanesulfonate (PubChem CID 3798667) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (1,1,4-trimethylpyrrolidin-1-ium-3-yl)methanesulfonate.
| Compound Name | (1,1,4-trimethylpyrrolidin-1-ium-3-yl)methanesulfonate |
|---|---|
| PubChem CID | 3798667 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (1,1,4-trimethylpyrrolidin-1-ium-3-yl)methanesulfonate |
| SMILES | CC1C[N+](C)(C)CC1CS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H17NO3S/c1-7-4-9(2,3)5-8(7)6-13(10,11)12/h7-8H,4-6H2,1-3H3 |
| InChIKey | GVMSSDONHVHGNP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|