C18H32N4O2 — CID 3800262
2-(1-amino-2-methylbutyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-oxazole-4-carboxamide (PubChem CID 3800262) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(1-amino-2-methylbutyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-methylbutyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3800262 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 2-(1-amino-2-methylbutyl)-N-[3-(2-methylpiperidin-1-yl)propyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCC(C)C(N)c1nc(C(=O)NCCCN2CCCCC2C)co1 |
| InChI | InChI=1S/C18H32N4O2/c1-4-13(2)16(19)18-21-15(12-24-18)17(23)20-9-7-11-22-10-6-5-8-14(22)3/h12-14,16H,4-11,19H2,1-3H3,(H,20,23) |
| InChIKey | NYJIZKVEXJIICE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|