C16H27N3O2 — CID 97353226
2-ethyl-N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-1,3-oxazole-4-carboxamide (PubChem CID 97353226) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-ethyl-N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-ethyl-N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 97353226 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-ethyl-N-[4-[(2S)-2-methylpiperidin-1-yl]butyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCc1nc(C(=O)NCCCCN2CCCC[C@@H]2C)co1 |
| InChI | InChI=1S/C16H27N3O2/c1-3-15-18-14(12-21-15)16(20)17-9-5-7-11-19-10-6-4-8-13(19)2/h12-13H,3-11H2,1-2H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | HMLMMPDZUTVDMI-ZDUSSCGKSA-N |
| XLogP | 2.62 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|