C21H24N2O6 — CID 38002802
(3S)-5-oxo-N-phenylmethoxy-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 38002802) has the molecular formula C21H24N2O6 and a molecular weight of 400.43 g/mol. Its IUPAC name is (3S)-5-oxo-N-phenylmethoxy-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-5-oxo-N-phenylmethoxy-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 38002802 |
| Molecular Formula | C21H24N2O6 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (3S)-5-oxo-N-phenylmethoxy-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc(N2C[C@@H](C(=O)NOCc3ccccc3)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O6/c1-26-17-10-16(11-18(27-2)20(17)28-3)23-12-15(9-19(23)24)21(25)22-29-13-14-7-5-4-6-8-14/h4-8,10-11,15H,9,12-13H2,1-3H3,(H,22,25)/t15-/m0/s1 |
| InChIKey | OACRASASAGKYMM-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|