C21H24N2O5 — CID 46585682
N-benzyl-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 46585682) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-benzyl-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-benzyl-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46585682 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-benzyl-5-oxo-1-(3,4,5-trimethoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | COc1cc(N2CC(C(=O)NCc3ccccc3)CC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H24N2O5/c1-26-17-10-16(11-18(27-2)20(17)28-3)23-13-15(9-19(23)24)21(25)22-12-14-7-5-4-6-8-14/h4-8,10-11,15H,9,12-13H2,1-3H3,(H,22,25) |
| InChIKey | LNHPILXLNHJZHF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |