C20H23N3O3 — CID 3800323
5-[N-[2-(cyclohexen-1-yl)ethyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione (PubChem CID 3800323) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 5-[N-[2-(cyclohexen-1-yl)ethyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione.
| Compound Name | 5-[N-[2-(cyclohexen-1-yl)ethyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3800323 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 5-[N-[2-(cyclohexen-1-yl)ethyl]-C-methylcarbonimidoyl]-6-hydroxy-1-phenylpyrimidine-2,4-dione |
| SMILES | C/C(=N\CCC1=CCCCC1)c1c(O)n(-c2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H23N3O3/c1-14(21-13-12-15-8-4-2-5-9-15)17-18(24)22-20(26)23(19(17)25)16-10-6-3-7-11-16/h3,6-8,10-11,25H,2,4-5,9,12-13H2,1H3,(H,22,24,26)/b21-14+ |
| InChIKey | OMHYDYLKPWQCAL-KGENOOAVSA-N |
| XLogP | 2.93 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|