About N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide
N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide (PubChem CID 937012) has the molecular formula C17H18N4O4
and a molecular weight of 342.36 g/mol. Its IUPAC name is N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide |
| PubChem CID | 937012 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide |
| SMILES | C=CCn1c(O)c(/C(C)=N/c2ccc(NC(C)=O)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H18N4O4/c1-4-9-21-16(24)14(15(23)20-17(21)25)10(2)18-12-5-7-13(8-6-12)19-11(3)22/h4-8,24H,1,9H2,2-3H3,(H,19,22)(H,20,23,25)/b18-10+ |
| InChIKey | FHFUUTMTMPIHBN-VCHYOVAHSA-N |
| XLogP | 1.53 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide?
The IUPAC name of N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide (CID 937012) is N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide.
What is the SMILES notation for N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide?
The canonical SMILES for N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide is C=CCn1c(O)c(/C(C)=N/c2ccc(NC(C)=O)cc2)c(=O)[nH]c1=O.
What is the InChIKey of N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide?
The InChIKey is FHFUUTMTMPIHBN-VCHYOVAHSA-N. The full InChI is InChI=1S/C17H18N4O4/c1-4-9-21-16(24)14(15(23)20-17(21)25)10(2)18-12-5-7-13(8-6-12)19-11(3)22/h4-8,24H,1,9H2,2-3H3,(H,19,22)(H,20,23,25)/b18-10+.
What are the key properties of N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide?
N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide has a molecular weight of 342.36 g/mol, XLogP of 1.53, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[1-(6-hydroxy-2,4-dioxo-1-prop-2-enylpyrimidin-5-yl)ethylideneamino]phenyl]acetamide is sourced from PubChem (CID 937012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).