C23H31NO3 — CID 38005769
3-(3,4-diethoxyphenyl)-N-[(1S)-1-(2,5-dimethylphenyl)ethyl]propanamide (PubChem CID 38005769) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-[(1S)-1-(2,5-dimethylphenyl)ethyl]propanamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-[(1S)-1-(2,5-dimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 38005769 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-[(1S)-1-(2,5-dimethylphenyl)ethyl]propanamide |
| SMILES | CCOc1ccc(CCC(=O)N[C@@H](C)c2cc(C)ccc2C)cc1OCC |
| InChI | InChI=1S/C23H31NO3/c1-6-26-21-12-10-19(15-22(21)27-7-2)11-13-23(25)24-18(5)20-14-16(3)8-9-17(20)4/h8-10,12,14-15,18H,6-7,11,13H2,1-5H3,(H,24,25)/t18-/m0/s1 |
| InChIKey | SODURQNVUGBZEX-SFHVURJKSA-N |
| XLogP | 4.91 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |