C15H21N3OS — CID 38006616
1-ethyl-N-[(3-methylthiophen-2-yl)methyl]-3-propan-2-ylpyrazole-5-carboxamide (PubChem CID 38006616) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-ethyl-N-[(3-methylthiophen-2-yl)methyl]-3-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[(3-methylthiophen-2-yl)methyl]-3-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 38006616 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-ethyl-N-[(3-methylthiophen-2-yl)methyl]-3-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CCn1nc(C(C)C)cc1C(=O)NCc1sccc1C |
| InChI | InChI=1S/C15H21N3OS/c1-5-18-13(8-12(17-18)10(2)3)15(19)16-9-14-11(4)6-7-20-14/h6-8,10H,5,9H2,1-4H3,(H,16,19) |
| InChIKey | AKRAVNUOKWUMFK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |