C25H33FN2O4S — CID 38006975
1-[(4-fluorophenyl)methylsulfonyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-4-carboxamide (PubChem CID 38006975) has the molecular formula C25H33FN2O4S and a molecular weight of 476.61 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methylsulfonyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methylsulfonyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38006975 |
| Molecular Formula | C25H33FN2O4S |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-[(4-fluorophenyl)methylsulfonyl]-N-[3-(4-propan-2-yloxyphenyl)propyl]piperidine-4-carboxamide |
| SMILES | CC(C)Oc1ccc(CCCNC(=O)C2CCN(S(=O)(=O)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H33FN2O4S/c1-19(2)32-24-11-7-20(8-12-24)4-3-15-27-25(29)22-13-16-28(17-14-22)33(30,31)18-21-5-9-23(26)10-6-21/h5-12,19,22H,3-4,13-18H2,1-2H3,(H,27,29) |
| InChIKey | CSHUFCDWKWYJPS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|