C21H34N2O4S — CID 55778343
1-butylsulfonyl-N-[2-(4-propan-2-yloxyphenyl)ethyl]piperidine-4-carboxamide (PubChem CID 55778343) has the molecular formula C21H34N2O4S and a molecular weight of 410.58 g/mol. Its IUPAC name is 1-butylsulfonyl-N-[2-(4-propan-2-yloxyphenyl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-butylsulfonyl-N-[2-(4-propan-2-yloxyphenyl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55778343 |
| Molecular Formula | C21H34N2O4S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 1-butylsulfonyl-N-[2-(4-propan-2-yloxyphenyl)ethyl]piperidine-4-carboxamide |
| SMILES | CCCCS(=O)(=O)N1CCC(C(=O)NCCc2ccc(OC(C)C)cc2)CC1 |
| InChI | InChI=1S/C21H34N2O4S/c1-4-5-16-28(25,26)23-14-11-19(12-15-23)21(24)22-13-10-18-6-8-20(9-7-18)27-17(2)3/h6-9,17,19H,4-5,10-16H2,1-3H3,(H,22,24) |
| InChIKey | MFKASEZTEDDYME-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |