C22H23ClN6O3 — CID 38035639
[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(5-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl)methanone (PubChem CID 38035639) has the molecular formula C22H23ClN6O3 and a molecular weight of 454.92 g/mol. Its IUPAC name is [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(5-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl)methanone.
| Compound Name | [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(5-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 38035639 |
| Molecular Formula | C22H23ClN6O3 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [4-(4-chloro-2-nitrophenyl)piperazin-1-yl]-(5-propan-2-yl-1-pyridin-2-ylpyrazol-4-yl)methanone |
| SMILES | CC(C)c1c(C(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C22H23ClN6O3/c1-15(2)21-17(14-25-28(21)20-5-3-4-8-24-20)22(30)27-11-9-26(10-12-27)18-7-6-16(23)13-19(18)29(31)32/h3-8,13-15H,9-12H2,1-2H3 |
| InChIKey | REMYQWKEVVLEGN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|