C25H25N3O3 — CID 38042817
N-cyclopropyl-4-[[cyclopropyl-[2-(2-methyl-1H-indol-3-yl)-2-oxoacetyl]amino]methyl]benzamide (PubChem CID 38042817) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-cyclopropyl-4-[[cyclopropyl-[2-(2-methyl-1H-indol-3-yl)-2-oxoacetyl]amino]methyl]benzamide.
| Compound Name | N-cyclopropyl-4-[[cyclopropyl-[2-(2-methyl-1H-indol-3-yl)-2-oxoacetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 38042817 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-cyclopropyl-4-[[cyclopropyl-[2-(2-methyl-1H-indol-3-yl)-2-oxoacetyl]amino]methyl]benzamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)N(Cc1ccc(C(=O)NC2CC2)cc1)C1CC1 |
| InChI | InChI=1S/C25H25N3O3/c1-15-22(20-4-2-3-5-21(20)26-15)23(29)25(31)28(19-12-13-19)14-16-6-8-17(9-7-16)24(30)27-18-10-11-18/h2-9,18-19,26H,10-14H2,1H3,(H,27,30) |
| InChIKey | MZUROWZURQBUIX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|