C19H17BrN2O3S — CID 38044186
N-[5-[(2-bromophenyl)methyl-methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 38044186) has the molecular formula C19H17BrN2O3S and a molecular weight of 433.33 g/mol. Its IUPAC name is N-[5-[(2-bromophenyl)methyl-methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(2-bromophenyl)methyl-methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 38044186 |
| Molecular Formula | C19H17BrN2O3S |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | N-[5-[(2-bromophenyl)methyl-methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccco2)sc1C(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C19H17BrN2O3S/c1-12-10-16(21-18(23)15-8-5-9-25-15)26-17(12)19(24)22(2)11-13-6-3-4-7-14(13)20/h3-10H,11H2,1-2H3,(H,21,23) |
| InChIKey | MRTDAOSLZZNPQX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |