C24H33NO3 — CID 3804515
3-[[2-(2-methoxyphenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 3804515) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 3-[[2-(2-methoxyphenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 3-[[2-(2-methoxyphenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 3804515 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 3-[[2-(2-methoxyphenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | COc1ccccc1CCNCC1C(=O)OC2CC3(C)CCCC(C)C3=CC21 |
| InChI | InChI=1S/C24H33NO3/c1-16-7-6-11-24(2)14-22-18(13-20(16)24)19(23(26)28-22)15-25-12-10-17-8-4-5-9-21(17)27-3/h4-5,8-9,13,16,18-19,22,25H,6-7,10-12,14-15H2,1-3H3 |
| InChIKey | OIPXGHPONYZIRJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|