C23H30FNO2 — CID 6575573
(3S,3aR,5S,8aR,9aR)-3-[[2-(4-fluorophenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 6575573) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is (3S,3aR,5S,8aR,9aR)-3-[[2-(4-fluorophenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aR,5S,8aR,9aR)-3-[[2-(4-fluorophenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 6575573 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (3S,3aR,5S,8aR,9aR)-3-[[2-(4-fluorophenyl)ethylamino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](CNCCc4ccc(F)cc4)[C@H]3C=C12 |
| InChI | InChI=1S/C23H30FNO2/c1-15-4-3-10-23(2)13-21-18(12-20(15)23)19(22(26)27-21)14-25-11-9-16-5-7-17(24)8-6-16/h5-8,12,15,18-19,21,25H,3-4,9-11,13-14H2,1-2H3/t15-,18+,19+,21+,23+/m0/s1 |
| InChIKey | FFSNVRAKSCJUEN-LOHSHHQESA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|