C27H37NO4 — CID 163071986
(3S,3aS,5R,8aS,9aR)-3-[[[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]amino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 163071986) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is (3S,3aS,5R,8aS,9aR)-3-[[[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]amino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,5R,8aS,9aR)-3-[[[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]amino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 163071986 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | (3S,3aS,5R,8aS,9aR)-3-[[[(4S,5R)-2,2-dimethyl-4-phenyl-1,3-dioxan-5-yl]amino]methyl]-5,8a-dimethyl-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@@H]1CCC[C@@]2(C)C[C@H]3OC(=O)[C@H](CN[C@@H]4COC(C)(C)O[C@H]4c4ccccc4)[C@@H]3C=C12 |
| InChI | InChI=1S/C27H37NO4/c1-17-9-8-12-27(4)14-23-19(13-21(17)27)20(25(29)31-23)15-28-22-16-30-26(2,3)32-24(22)18-10-6-5-7-11-18/h5-7,10-11,13,17,19-20,22-24,28H,8-9,12,14-16H2,1-4H3/t17-,19+,20-,22-,23-,24+,27+/m1/s1 |
| InChIKey | OHPNSNVEQOAVGJ-WMWRBFJWSA-N |
| XLogP | 4.78 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|