C23H32NO2+ — CID 7091590
[(3R,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-benzyl-methylazanium (PubChem CID 7091590) has the molecular formula C23H32NO2+ and a molecular weight of 354.51 g/mol. Its IUPAC name is [(3R,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-benzyl-methylazanium.
| Compound Name | [(3R,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-benzyl-methylazanium |
|---|---|
| PubChem CID | 7091590 |
| Molecular Formula | C23H32NO2+ |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(3R,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-benzyl-methylazanium |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@@H](C[NH+](C)Cc4ccccc4)[C@H]3C=C12 |
| InChI | InChI=1S/C23H31NO2/c1-16-8-7-11-23(2)13-21-18(12-20(16)23)19(22(25)26-21)15-24(3)14-17-9-5-4-6-10-17/h4-6,9-10,12,16,18-19,21H,7-8,11,13-15H2,1-3H3/p+1/t16-,18+,19-,21+,23+/m0/s1 |
| InChIKey | OFXZQIJQJISEJF-FEJROSIGSA-O |
| XLogP | 3.02 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|