C25H36NO4+ — CID 11876777
[(3S,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(furan-2-ylmethyl)-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 11876777) has the molecular formula C25H36NO4+ and a molecular weight of 414.57 g/mol. Its IUPAC name is [(3S,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(furan-2-ylmethyl)-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [(3S,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(furan-2-ylmethyl)-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 11876777 |
| Molecular Formula | C25H36NO4+ |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | [(3S,3aR,5S,8aR,9aR)-5,8a-dimethyl-2-oxo-3,3a,5,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl]methyl-(furan-2-ylmethyl)-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | C[C@H]1CCC[C@]2(C)C[C@H]3OC(=O)[C@H](C[NH+](Cc4ccco4)C[C@H]4CCCO4)[C@H]3C=C12 |
| InChI | InChI=1S/C25H35NO4/c1-17-6-3-9-25(2)13-23-20(12-22(17)25)21(24(27)30-23)16-26(14-18-7-4-10-28-18)15-19-8-5-11-29-19/h4,7,10,12,17,19-21,23H,3,5-6,8-9,11,13-16H2,1-2H3/p+1/t17-,19+,20+,21+,23+,25+/m0/s1 |
| InChIKey | YSZZLAPSDPZFFH-JWWWDENJSA-O |
| XLogP | 3.16 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|