C28H25N3O2 — CID 3804747
N-(furan-2-ylmethyl)-N-[(4-methoxyphenyl)methyl]-6-methyl-4-phenylquinazolin-2-amine (PubChem CID 3804747) has the molecular formula C28H25N3O2 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(4-methoxyphenyl)methyl]-6-methyl-4-phenylquinazolin-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-N-[(4-methoxyphenyl)methyl]-6-methyl-4-phenylquinazolin-2-amine |
|---|---|
| PubChem CID | 3804747 |
| Molecular Formula | C28H25N3O2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(4-methoxyphenyl)methyl]-6-methyl-4-phenylquinazolin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccco2)c2nc(-c3ccccc3)c3cc(C)ccc3n2)cc1 |
| InChI | InChI=1S/C28H25N3O2/c1-20-10-15-26-25(17-20)27(22-7-4-3-5-8-22)30-28(29-26)31(19-24-9-6-16-33-24)18-21-11-13-23(32-2)14-12-21/h3-17H,18-19H2,1-2H3 |
| InChIKey | GXMDRIIZIHBLDQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |